C28H24FN9O6 — CID 90730023
4-[(1R)-1-[[2-amino-5-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]ethyl]benzoic acid (PubChem CID 90730023) has the molecular formula C28H24FN9O6 and a molecular weight of 601.56 g/mol. Its IUPAC name is 4-[(1R)-1-[[2-amino-5-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1R)-1-[[2-amino-5-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 90730023 |
| Molecular Formula | C28H24FN9O6 |
| Molecular Weight | 601.56 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | 4-[(1R)-1-[[2-amino-5-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]ethyl]benzoic acid |
| SMILES | C[C@@H](NC(=O)c1cc(C(=O)NCc2ccc(F)c(CNc3c(N)c(=O)c3=O)c2)nc2nc(N)nn12)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H24FN9O6/c1-12(14-3-5-15(6-4-14)26(43)44)34-25(42)19-9-18(35-28-36-27(31)37-38(19)28)24(41)33-10-13-2-7-17(29)16(8-13)11-32-21-20(30)22(39)23(21)40/h2-9,12,32H,10-11,30H2,1H3,(H2,31,37)(H,33,41)(H,34,42)(H,43,44)/t12-/m1/s1 |
| InChIKey | IUPJCBHHUNKWPL-GFCCVEGCSA-N |
| XLogP | 0.76 |
| TPSA | 236.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.56 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|