About 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione
3-naphthalen-1-yl-2H-1,2-oxazole-5-thione (PubChem CID 90730202) has the molecular formula C13H9NOS
and a molecular weight of 227.29 g/mol. Its IUPAC name is 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione.
Molecular Properties
| Compound Name | 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione |
| PubChem CID | 90730202 |
| Molecular Formula | C13H9NOS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione |
| SMILES | S=c1cc(-c2cccc3ccccc23)[nH]o1 |
| InChI | InChI=1S/C13H9NOS/c16-13-8-12(14-15-13)11-7-3-5-9-4-1-2-6-10(9)11/h1-8,14H |
| InChIKey | VOJVMNGYZVWHGG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione?
The IUPAC name of 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione (CID 90730202) is 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione.
What is the SMILES notation for 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione?
The canonical SMILES for 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione is S=c1cc(-c2cccc3ccccc23)[nH]o1.
What is the InChIKey of 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione?
The InChIKey is VOJVMNGYZVWHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NOS/c16-13-8-12(14-15-13)11-7-3-5-9-4-1-2-6-10(9)11/h1-8,14H.
What are the key properties of 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione?
3-naphthalen-1-yl-2H-1,2-oxazole-5-thione has a molecular weight of 227.29 g/mol, XLogP of 4.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-1-yl-2H-1,2-oxazole-5-thione is sourced from PubChem (CID 90730202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).