C17H24N6O8 — CID 90730279
3-[4-ethyl-2,2,6,6-tetrahydroxy-3-[methyl-(2-oxo-1,3,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-2,2-dihydroxy-3-oxopropanenitrile (PubChem CID 90730279) has the molecular formula C17H24N6O8 and a molecular weight of 440.41 g/mol. Its IUPAC name is 3-[4-ethyl-2,2,6,6-tetrahydroxy-3-[methyl-(2-oxo-1,3,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-2,2-dihydroxy-3-oxopropanenitrile.
| Compound Name | 3-[4-ethyl-2,2,6,6-tetrahydroxy-3-[methyl-(2-oxo-1,3,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-2,2-dihydroxy-3-oxopropanenitrile |
|---|---|
| PubChem CID | 90730279 |
| Molecular Formula | C17H24N6O8 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-[4-ethyl-2,2,6,6-tetrahydroxy-3-[methyl-(2-oxo-1,3,7,7a-tetrahydropyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-2,2-dihydroxy-3-oxopropanenitrile |
| SMILES | CCC1CC(O)(O)N(C(=O)C(O)(O)C#N)C(O)(O)C1N(C)C1=C2C=CNC2NC(=O)N1 |
| InChI | InChI=1S/C17H24N6O8/c1-3-8-6-16(28,29)23(13(24)15(26,27)7-18)17(30,31)10(8)22(2)12-9-4-5-19-11(9)20-14(25)21-12/h4-5,8,10-11,19,26-31H,3,6H2,1-2H3,(H2,20,21,25) |
| InChIKey | UVTVKSLDLWQHNX-UHFFFAOYSA-N |
| XLogP | -4.01 |
| TPSA | 221.88 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|