C23H21ClFNO7S2 — CID 90730677
3-hydroxypropyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate (PubChem CID 90730677) has the molecular formula C23H21ClFNO7S2 and a molecular weight of 542.01 g/mol. Its IUPAC name is 3-hydroxypropyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate.
| Compound Name | 3-hydroxypropyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90730677 |
| Molecular Formula | C23H21ClFNO7S2 |
| Molecular Weight | 542.01 g/mol |
| Exact Mass | 541.04 |
| IUPAC Name | 3-hydroxypropyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
| SMILES | CC1=NC2=C(C(c3c(F)cccc3Cl)C1C(=O)OCCCO)S(=O)(=O)c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C23H21ClFNO7S2/c1-13-19(23(28)33-11-5-10-27)21(20-14(24)6-4-7-15(20)25)22-16(26-13)12-34(29,30)17-8-2-3-9-18(17)35(22,31)32/h2-4,6-9,19,21,27H,5,10-12H2,1H3 |
| InChIKey | MVVZAJHRACWHKO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.01 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|