C23H20F3N3O5 — CID 90730915
N-[[1-hydroxy-2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]isoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 90730915) has the molecular formula C23H20F3N3O5 and a molecular weight of 475.42 g/mol. Its IUPAC name is N-[[1-hydroxy-2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]isoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[[1-hydroxy-2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]isoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 90730915 |
| Molecular Formula | C23H20F3N3O5 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N-[[1-hydroxy-2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]isoindol-5-yl]methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | C[C@]1(n2cc3cc(CNC(=O)c4ccc(OC(F)(F)F)cc4)ccc3c2O)CCC(=O)NC1=O |
| InChI | InChI=1S/C23H20F3N3O5/c1-22(9-8-18(30)28-21(22)33)29-12-15-10-13(2-7-17(15)20(29)32)11-27-19(31)14-3-5-16(6-4-14)34-23(24,25)26/h2-7,10,12,32H,8-9,11H2,1H3,(H,27,31)(H,28,30,33)/t22-/m0/s1 |
| InChIKey | OSSFISKWYSJVHI-QFIPXVFZSA-N |
| XLogP | 3.33 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|