C28H28O5 — CID 90731068
naphthalen-2-yl 2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]acetate (PubChem CID 90731068) has the molecular formula C28H28O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is naphthalen-2-yl 2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]acetate.
| Compound Name | naphthalen-2-yl 2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 90731068 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | naphthalen-2-yl 2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]acetate |
| SMILES | O=C(C[C@H]1C(=O)C[C@@H](O)[C@@H]1C=C[C@@H](O)CCc1ccccc1)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H28O5/c29-22(12-10-19-6-2-1-3-7-19)13-15-24-25(27(31)18-26(24)30)17-28(32)33-23-14-11-20-8-4-5-9-21(20)16-23/h1-9,11,13-16,22,24-26,29-30H,10,12,17-18H2/t22-,24+,25+,26+/m0/s1 |
| InChIKey | KWIOIENGGGJPCI-DZWGLGNASA-N |
| XLogP | 4.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|