C19H14F3N3O4 — CID 90731091
2-(trifluoromethyl)-4-[(6S)-1,3,6-trihydroxy-6-isocyano-4,7-dimethyl-5H-4,7-epoxyisoindol-2-yl]benzonitrile (PubChem CID 90731091) has the molecular formula C19H14F3N3O4 and a molecular weight of 405.33 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-[(6S)-1,3,6-trihydroxy-6-isocyano-4,7-dimethyl-5H-4,7-epoxyisoindol-2-yl]benzonitrile.
| Compound Name | 2-(trifluoromethyl)-4-[(6S)-1,3,6-trihydroxy-6-isocyano-4,7-dimethyl-5H-4,7-epoxyisoindol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 90731091 |
| Molecular Formula | C19H14F3N3O4 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-(trifluoromethyl)-4-[(6S)-1,3,6-trihydroxy-6-isocyano-4,7-dimethyl-5H-4,7-epoxyisoindol-2-yl]benzonitrile |
| SMILES | [C-]#[N+][C@]1(O)CC2(C)OC1(C)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C19H14F3N3O4/c1-16-8-18(28,24-3)17(2,29-16)13-12(16)14(26)25(15(13)27)10-5-4-9(7-23)11(6-10)19(20,21)22/h4-6,26-28H,8H2,1-2H3/t16?,17?,18-/m0/s1 |
| InChIKey | DLNNRDHWTMTXAL-ABHNRTSZSA-N |
| XLogP | 3.25 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|