About 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione
2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione (PubChem CID 90731117) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione.
Molecular Properties
| Compound Name | 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione |
| PubChem CID | 90731117 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione |
| SMILES | O=C1C/C(=N\CCO)C(=O)C/C1=N\CCO |
| InChI | InChI=1S/C10H14N2O4/c13-3-1-11-7-5-10(16)8(6-9(7)15)12-2-4-14/h13-14H,1-6H2/b11-7+,12-8+ |
| InChIKey | HPEOQSCNSGUSIS-MKICQXMISA-N |
| XLogP | -1.22 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione?
The IUPAC name of 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione (CID 90731117) is 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione.
What is the SMILES notation for 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione?
The canonical SMILES for 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione is O=C1C/C(=N\CCO)C(=O)C/C1=N\CCO.
What is the InChIKey of 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione?
The InChIKey is HPEOQSCNSGUSIS-MKICQXMISA-N. The full InChI is InChI=1S/C10H14N2O4/c13-3-1-11-7-5-10(16)8(6-9(7)15)12-2-4-14/h13-14H,1-6H2/b11-7+,12-8+.
What are the key properties of 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione?
2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione has a molecular weight of 226.23 g/mol, XLogP of -1.22, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(2-hydroxyethylimino)cyclohexane-1,4-dione is sourced from PubChem (CID 90731117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).