About 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride
4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride (PubChem CID 90731192) has the molecular formula C9H8Cl3N2O3P
and a molecular weight of 329.51 g/mol. Its IUPAC name is 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride.
Molecular Properties
| Compound Name | 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride |
| PubChem CID | 90731192 |
| Molecular Formula | C9H8Cl3N2O3P |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride |
| SMILES | Cc1cnc2c(O)cc(=O)[nH]c2c1.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H8N2O2.Cl3OP/c1-5-2-6-9(10-4-5)7(12)3-8(13)11-6;1-5(2,3)4/h2-4H,1H3,(H2,11,12,13); |
| InChIKey | XVNJOECTTVKGNS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride?
The IUPAC name of 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride (CID 90731192) is 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride.
What is the SMILES notation for 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride?
The canonical SMILES for 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride is Cc1cnc2c(O)cc(=O)[nH]c2c1.O=P(Cl)(Cl)Cl.
What is the InChIKey of 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride?
The InChIKey is XVNJOECTTVKGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2.Cl3OP/c1-5-2-6-9(10-4-5)7(12)3-8(13)11-6;1-5(2,3)4/h2-4H,1H3,(H2,11,12,13);.
What are the key properties of 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride?
4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride has a molecular weight of 329.51 g/mol, XLogP of 3.75, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-7-methyl-1H-1,5-naphthyridin-2-one;phosphoryl trichloride is sourced from PubChem (CID 90731192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).