C12H16BrNO2 — CID 90731425
3-bromo-5-(5-methoxyhepta-1,3,5-trien-2-yl)-4-methyl-2,5-dihydro-1,2-oxazole (PubChem CID 90731425) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 3-bromo-5-(5-methoxyhepta-1,3,5-trien-2-yl)-4-methyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-bromo-5-(5-methoxyhepta-1,3,5-trien-2-yl)-4-methyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 90731425 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 3-bromo-5-(5-methoxyhepta-1,3,5-trien-2-yl)-4-methyl-2,5-dihydro-1,2-oxazole |
| SMILES | C=C(C=CC(=CC)OC)C1ONC(Br)=C1C |
| InChI | InChI=1S/C12H16BrNO2/c1-5-10(15-4)7-6-8(2)11-9(3)12(13)14-16-11/h5-7,11,14H,2H2,1,3-4H3 |
| InChIKey | DLGZPOCLWNAEQX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|