C20H22O12 — CID 90732237
tetramethyl (3aS,4R,6aS)-2,5-diacetyloxy-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate (PubChem CID 90732237) has the molecular formula C20H22O12 and a molecular weight of 454.38 g/mol. Its IUPAC name is tetramethyl (3aS,4R,6aS)-2,5-diacetyloxy-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate.
| Compound Name | tetramethyl (3aS,4R,6aS)-2,5-diacetyloxy-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 90732237 |
| Molecular Formula | C20H22O12 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | tetramethyl (3aS,4R,6aS)-2,5-diacetyloxy-1,3a,4,6a-tetrahydropentalene-1,3,4,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(OC(C)=O)C(C(=O)OC)[C@H]2C(C(=O)OC)=C(OC(C)=O)[C@H](C(=O)OC)[C@@H]12 |
| InChI | InChI=1S/C20H22O12/c1-7(21)31-15-11(17(23)27-3)9-10(12(15)18(24)28-4)14(20(26)30-6)16(32-8(2)22)13(9)19(25)29-5/h9-11,14H,1-6H3/t9-,10+,11+,14?/m0/s1 |
| InChIKey | DYULNEUBJKSXLB-XBZGWKTJSA-N |
| XLogP | -0.20 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|