C15H15ClN4O2 — CID 90732303
4-(2-chlorophenyl)-5-nitro-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 90732303) has the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-nitro-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(2-chlorophenyl)-5-nitro-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 90732303 |
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-(2-chlorophenyl)-5-nitro-6-propyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | CCCC1=Nc2[nH]ncc2C(c2ccccc2Cl)C1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15ClN4O2/c1-2-5-12-14(20(21)22)13(9-6-3-4-7-11(9)16)10-8-17-19-15(10)18-12/h3-4,6-8,13-14H,2,5H2,1H3,(H,17,19) |
| InChIKey | MZKNDMPLMWMMND-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|