C11H18N2 — CID 90732409
2,2,5,7,7-pentamethyl-1,4-diazocine (PubChem CID 90732409) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2,2,5,7,7-pentamethyl-1,4-diazocine.
| Compound Name | 2,2,5,7,7-pentamethyl-1,4-diazocine |
|---|---|
| PubChem CID | 90732409 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2,2,5,7,7-pentamethyl-1,4-diazocine |
| SMILES | CC1=CC(C)(C)/C=N\C(C)(C)/C=N\1 |
| InChI | InChI=1S/C11H18N2/c1-9-6-10(2,3)7-13-11(4,5)8-12-9/h6-8H,1-5H3/b9-6?,12-8-,13-7- |
| InChIKey | GNEMPMGYUDRUIS-ZSBBOFLISA-N |
| XLogP | 2.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |