About 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene
1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene (PubChem CID 90732663) has the molecular formula C22H21BrN2O4
and a molecular weight of 457.32 g/mol. Its IUPAC name is 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene |
| PubChem CID | 90732663 |
| Molecular Formula | C22H21BrN2O4 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-c1c(C)cccc1C.Cc1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C15H15NO2.C7H6BrNO2/c1-10-5-4-6-11(2)15(10)14-8-7-13(16(17)18)9-12(14)3;1-5-4-6(9(10)11)2-3-7(5)8/h4-9H,1-3H3;2-4H,1H3 |
| InChIKey | FDQJRYIVWWEGTF-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene?
The IUPAC name of 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene (CID 90732663) is 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene.
What is the SMILES notation for 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene?
The canonical SMILES for 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene is Cc1cc([N+](=O)[O-])ccc1-c1c(C)cccc1C.Cc1cc([N+](=O)[O-])ccc1Br.
What is the InChIKey of 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene?
The InChIKey is FDQJRYIVWWEGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2.C7H6BrNO2/c1-10-5-4-6-11(2)15(10)14-8-7-13(16(17)18)9-12(14)3;1-5-4-6(9(10)11)2-3-7(5)8/h4-9H,1-3H3;2-4H,1H3.
What are the key properties of 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene?
1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene has a molecular weight of 457.32 g/mol, XLogP of 6.85, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methyl-4-nitrobenzene;1,3-dimethyl-2-(2-methyl-4-nitrophenyl)benzene is sourced from PubChem (CID 90732663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).