About 10b,10c-dihydropyren-1-ol;ethane;propane
10b,10c-dihydropyren-1-ol;ethane;propane (PubChem CID 90732805) has the molecular formula C21H26O
and a molecular weight of 294.44 g/mol. Its IUPAC name is 10b,10c-dihydropyren-1-ol;ethane;propane.
Molecular Properties
| Compound Name | 10b,10c-dihydropyren-1-ol;ethane;propane |
| PubChem CID | 90732805 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 10b,10c-dihydropyren-1-ol;ethane;propane |
| SMILES | CC.CCC.OC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2C34 |
| InChI | InChI=1S/C16H12O.C3H8.C2H6/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;1-3-2;1-2/h1-9,15-17H;3H2,1-2H3;1-2H3 |
| InChIKey | PGWGBJXCLKGSSH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10b,10c-dihydropyren-1-ol;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10b,10c-dihydropyren-1-ol;ethane;propane?
The IUPAC name of 10b,10c-dihydropyren-1-ol;ethane;propane (CID 90732805) is 10b,10c-dihydropyren-1-ol;ethane;propane.
What is the SMILES notation for 10b,10c-dihydropyren-1-ol;ethane;propane?
The canonical SMILES for 10b,10c-dihydropyren-1-ol;ethane;propane is CC.CCC.OC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2C34.
What is the InChIKey of 10b,10c-dihydropyren-1-ol;ethane;propane?
The InChIKey is PGWGBJXCLKGSSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O.C3H8.C2H6/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;1-3-2;1-2/h1-9,15-17H;3H2,1-2H3;1-2H3.
What are the key properties of 10b,10c-dihydropyren-1-ol;ethane;propane?
10b,10c-dihydropyren-1-ol;ethane;propane has a molecular weight of 294.44 g/mol, XLogP of 5.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10b,10c-dihydropyren-1-ol;ethane;propane is sourced from PubChem (CID 90732805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).