C24H29NO3 — CID 90732907
tert-butyl 2-[4-(1-hydroxy-6-propylisoindol-2-yl)phenyl]propanoate (PubChem CID 90732907) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl 2-[4-(1-hydroxy-6-propylisoindol-2-yl)phenyl]propanoate.
| Compound Name | tert-butyl 2-[4-(1-hydroxy-6-propylisoindol-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 90732907 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | tert-butyl 2-[4-(1-hydroxy-6-propylisoindol-2-yl)phenyl]propanoate |
| SMILES | CCCc1ccc2cn(-c3ccc(C(C)C(=O)OC(C)(C)C)cc3)c(O)c2c1 |
| InChI | InChI=1S/C24H29NO3/c1-6-7-17-8-9-19-15-25(22(26)21(19)14-17)20-12-10-18(11-13-20)16(2)23(27)28-24(3,4)5/h8-16,26H,6-7H2,1-5H3 |
| InChIKey | JFDQRVTWWPINBY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |