C11H18O8 — CID 90733296
2-[[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]methylidene]butanoic acid (PubChem CID 90733296) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-[[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]methylidene]butanoic acid.
| Compound Name | 2-[[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 90733296 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-[[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]methylidene]butanoic acid |
| SMILES | CCC(=CC1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C11H18O8/c1-2-5(10(16)17)3-11(18)9(15)8(14)7(13)6(4-12)19-11/h3,6-9,12-15,18H,2,4H2,1H3,(H,16,17)/t6-,7-,8+,9-,11?/m1/s1 |
| InChIKey | GPJWBVWBUAGKRV-OGADHKOYSA-N |
| XLogP | -2.43 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|