C25H26F4N8O2 — CID 90733507
6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-[4-morpholin-2-yl-3-(trifluoromethyl)phenyl]pyridin-3-amine (PubChem CID 90733507) has the molecular formula C25H26F4N8O2 and a molecular weight of 546.53 g/mol. Its IUPAC name is 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-[4-morpholin-2-yl-3-(trifluoromethyl)phenyl]pyridin-3-amine.
| Compound Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-[4-morpholin-2-yl-3-(trifluoromethyl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 90733507 |
| Molecular Formula | C25H26F4N8O2 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-N-[4-morpholin-2-yl-3-(trifluoromethyl)phenyl]pyridin-3-amine |
| SMILES | Fc1cnc(/N=N/Cc2ccc(Nc3ccc(C4CNCCO4)c(C(F)(F)F)c3)cn2)nc1N1CCOCC1 |
| InChI | InChI=1S/C25H26F4N8O2/c26-21-14-32-24(35-23(21)37-6-9-38-10-7-37)36-33-13-17-1-2-18(12-31-17)34-16-3-4-19(20(11-16)25(27,28)29)22-15-30-5-8-39-22/h1-4,11-12,14,22,30,34H,5-10,13,15H2/b36-33+ |
| InChIKey | HNPOOYOCFDONOA-PKUSAGTQSA-N |
| XLogP | 4.55 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|