C21H19F3N2O6 — CID 90733527
2-[(4R,6S,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,6-trihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-4-yl]ethyl acetate (PubChem CID 90733527) has the molecular formula C21H19F3N2O6 and a molecular weight of 452.39 g/mol. Its IUPAC name is 2-[(4R,6S,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,6-trihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-4-yl]ethyl acetate.
| Compound Name | 2-[(4R,6S,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,6-trihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-4-yl]ethyl acetate |
|---|---|
| PubChem CID | 90733527 |
| Molecular Formula | C21H19F3N2O6 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-[(4R,6S,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3,6-trihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-4-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@]12C[C@H](O)[C@](C)(O1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C21H19F3N2O6/c1-10(27)31-6-5-20-8-14(28)19(2,32-20)15-16(20)18(30)26(17(15)29)12-4-3-11(9-25)13(7-12)21(22,23)24/h3-4,7,14,28-30H,5-6,8H2,1-2H3/t14-,19-,20+/m0/s1 |
| InChIKey | IMIIAYFTYZJWPP-PNHOKKKMSA-N |
| XLogP | 2.94 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |