C9H21N4O5PS2 — CID 90733726
[[(2S)-1-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]-1-oxobutan-2-yl]amino]methylphosphonic acid (PubChem CID 90733726) has the molecular formula C9H21N4O5PS2 and a molecular weight of 360.40 g/mol. Its IUPAC name is [[(2S)-1-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]-1-oxobutan-2-yl]amino]methylphosphonic acid.
| Compound Name | [[(2S)-1-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]-1-oxobutan-2-yl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 90733726 |
| Molecular Formula | C9H21N4O5PS2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [[(2S)-1-amino-4-[(3,4-diamino-4-oxobutyl)disulfanyl]-1-oxobutan-2-yl]amino]methylphosphonic acid |
| SMILES | NC(=O)C(N)CCSSCC[C@H](NCP(=O)(O)O)C(N)=O |
| InChI | InChI=1S/C9H21N4O5PS2/c10-6(8(11)14)1-3-20-21-4-2-7(9(12)15)13-5-19(16,17)18/h6-7,13H,1-5,10H2,(H2,11,14)(H2,12,15)(H2,16,17,18)/t6?,7-/m0/s1 |
| InChIKey | PQGUZGRMXYESGN-MLWJPKLSSA-N |
| XLogP | -1.46 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|