C44H40O14S2 — CID 90734010
[4-[4-[2-[2-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethoxy]ethoxy]phenyl]sulfonylphenyl] 2-hydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoate (PubChem CID 90734010) has the molecular formula C44H40O14S2 and a molecular weight of 856.92 g/mol. Its IUPAC name is [4-[4-[2-[2-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethoxy]ethoxy]phenyl]sulfonylphenyl] 2-hydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoate.
| Compound Name | [4-[4-[2-[2-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethoxy]ethoxy]phenyl]sulfonylphenyl] 2-hydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 90734010 |
| Molecular Formula | C44H40O14S2 |
| Molecular Weight | 856.92 g/mol |
| Exact Mass | 856.19 |
| IUPAC Name | [4-[4-[2-[2-[4-(4-hydroxyphenyl)sulfonylphenoxy]ethoxy]ethoxy]phenyl]sulfonylphenyl] 2-hydroxy-4-[2-(4-methoxyphenoxy)ethoxy]benzoate |
| SMILES | COc1ccc(OCCOc2ccc(C(=O)Oc3ccc(S(=O)(=O)c4ccc(OCCOCCOc5ccc(S(=O)(=O)c6ccc(O)cc6)cc5)cc4)cc3)c(O)c2)cc1 |
| InChI | InChI=1S/C44H40O14S2/c1-52-32-4-6-33(7-5-32)56-28-29-57-37-14-23-42(43(46)30-37)44(47)58-36-12-21-41(22-13-36)60(50,51)40-19-10-35(11-20-40)55-27-25-53-24-26-54-34-8-17-39(18-9-34)59(48,49)38-15-2-31(45)3-16-38/h2-23,30,45-46H,24-29H2,1H3 |
| InChIKey | GYDXKBXNHCEMLE-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 190.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.92 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|