C24H31FO5 — CID 90734047
7-[(1R,2R,3R)-2-[(3S)-4-[3-(2-fluoroethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 90734047) has the molecular formula C24H31FO5 and a molecular weight of 418.51 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(3S)-4-[3-(2-fluoroethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(3S)-4-[3-(2-fluoroethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 90734047 |
| Molecular Formula | C24H31FO5 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(3S)-4-[3-(2-fluoroethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1C(=O)C[C@@H](O)[C@@H]1C=C[C@@H](O)Cc1cccc(CCF)c1 |
| InChI | InChI=1S/C24H31FO5/c25-13-12-17-6-5-7-18(14-17)15-19(26)10-11-21-20(22(27)16-23(21)28)8-3-1-2-4-9-24(29)30/h1,3,5-7,10-11,14,19-21,23,26,28H,2,4,8-9,12-13,15-16H2,(H,29,30)/t19-,20-,21-,23-/m1/s1 |
| InChIKey | NIPBNSXYWBMEOV-YYTDSSBASA-N |
| XLogP | 3.43 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|