C13H12N4O2S — CID 90734062
5-[(4-amino-3-pyridinyl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90734062) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 5-[(4-amino-3-pyridinyl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(4-amino-3-pyridinyl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90734062 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-[(4-amino-3-pyridinyl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)C(=Cc2cnccc2N)C(=O)NC1=S |
| InChI | InChI=1S/C13H12N4O2S/c1-2-5-17-12(19)9(11(18)16-13(17)20)6-8-7-15-4-3-10(8)14/h2-4,6-7H,1,5H2,(H2,14,15)(H,16,18,20) |
| InChIKey | VLXIGYBAMWYLDF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|