C18H23NO3 — CID 90734162
[1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]methanol (PubChem CID 90734162) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is [1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]methanol.
| Compound Name | [1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 90734162 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | [1-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]methanol |
| SMILES | OCC1=CCCN(C(CC2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C18H23NO3/c20-13-16-7-4-8-19(12-16)17(18-14-21-9-10-22-18)11-15-5-2-1-3-6-15/h1-2,5,7,9-10,14,17,20H,3-4,6,8,11-13H2 |
| InChIKey | OOCBJSYBMBZYKV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|