C22H20F6N2O2 — CID 90734320
5-[2-[[2-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-hydroxyethyl]amino]ethyl]-2-methylphenol (PubChem CID 90734320) has the molecular formula C22H20F6N2O2 and a molecular weight of 458.40 g/mol. Its IUPAC name is 5-[2-[[2-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-hydroxyethyl]amino]ethyl]-2-methylphenol.
| Compound Name | 5-[2-[[2-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-hydroxyethyl]amino]ethyl]-2-methylphenol |
|---|---|
| PubChem CID | 90734320 |
| Molecular Formula | C22H20F6N2O2 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 5-[2-[[2-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-hydroxyethyl]amino]ethyl]-2-methylphenol |
| SMILES | Cc1ccc(CCNCC(O)c2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)cc1O |
| InChI | InChI=1S/C22H20F6N2O2/c1-12-5-6-13(9-17(12)31)7-8-29-11-18(32)15-10-19(22(26,27)28)30-20-14(15)3-2-4-16(20)21(23,24)25/h2-6,9-10,18,29,31-32H,7-8,11H2,1H3 |
| InChIKey | VQWYPAKWCBDCHH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|