C11H14N2O — CID 90734882
ethane;2-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 90734882) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is ethane;2-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | ethane;2-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 90734882 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | ethane;2-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC.Cc1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C9H8N2O.C2H6/c1-7-6-9(12)11-5-3-2-4-8(11)10-7;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | LMYAIFINLFWPMN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |