C30H47NO10 — CID 90735004
[(2S)-2-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxypropyl] 3,3-dimethylbutanoate (PubChem CID 90735004) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is [(2S)-2-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxypropyl] 3,3-dimethylbutanoate.
| Compound Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxypropyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 90735004 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxypropyl] 3,3-dimethylbutanoate |
| SMILES | CCCCCOC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)COC(=O)CC(C)(C)C)cc1OC(=O)OCCCCC |
| InChI | InChI=1S/C30H47NO10/c1-7-9-11-15-36-28(34)40-24-14-13-22(18-25(24)41-29(35)37-16-12-10-8-2)17-23(31)27(33)39-21(3)20-38-26(32)19-30(4,5)6/h13-14,18,21,23H,7-12,15-17,19-20,31H2,1-6H3/t21-,23-/m0/s1 |
| InChIKey | PQRVIFKWTRIARI-GMAHTHKFSA-N |
| XLogP | 5.88 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|