C21H30N2 — CID 90735090
2,4-diethyl-3,6-dimethyl-12-propyl-6,9-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),7,11,13-tetraene (PubChem CID 90735090) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 2,4-diethyl-3,6-dimethyl-12-propyl-6,9-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),7,11,13-tetraene.
| Compound Name | 2,4-diethyl-3,6-dimethyl-12-propyl-6,9-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),7,11,13-tetraene |
|---|---|
| PubChem CID | 90735090 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 2,4-diethyl-3,6-dimethyl-12-propyl-6,9-diazatetracyclo[8.4.0.02,4.05,9]tetradeca-1(10),7,11,13-tetraene |
| SMILES | CCCc1ccc2c(c1)N1C=CN(C)C1C1(CC)C(C)C21CC |
| InChI | InChI=1S/C21H30N2/c1-6-9-16-10-11-17-18(14-16)23-13-12-22(5)19(23)21(8-3)15(4)20(17,21)7-2/h10-15,19H,6-9H2,1-5H3 |
| InChIKey | WKNBUIUDIAUDRI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |