C9H10F2 — CID 90735152
4-fluoro-6-(fluoromethyl)octa-3,5-dien-1-yne (PubChem CID 90735152) has the molecular formula C9H10F2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-fluoro-6-(fluoromethyl)octa-3,5-dien-1-yne.
| Compound Name | 4-fluoro-6-(fluoromethyl)octa-3,5-dien-1-yne |
|---|---|
| PubChem CID | 90735152 |
| Molecular Formula | C9H10F2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4-fluoro-6-(fluoromethyl)octa-3,5-dien-1-yne |
| SMILES | C#CC=C(F)C=C(CC)CF |
| InChI | InChI=1S/C9H10F2/c1-3-5-9(11)6-8(4-2)7-10/h1,5-6H,4,7H2,2H3 |
| InChIKey | GPWQHKLQGCSSIA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|