C30H28N4O5 — CID 90735165
2-[5-[[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-ylidene]amino]-1,3,4-oxadiazol-2-yl]-N-[1-(1,3-dioxol-4-yl)-2-phenylethyl]aniline (PubChem CID 90735165) has the molecular formula C30H28N4O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is 2-[5-[[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-ylidene]amino]-1,3,4-oxadiazol-2-yl]-N-[1-(1,3-dioxol-4-yl)-2-phenylethyl]aniline.
| Compound Name | 2-[5-[[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-ylidene]amino]-1,3,4-oxadiazol-2-yl]-N-[1-(1,3-dioxol-4-yl)-2-phenylethyl]aniline |
|---|---|
| PubChem CID | 90735165 |
| Molecular Formula | C30H28N4O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 2-[5-[[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-ylidene]amino]-1,3,4-oxadiazol-2-yl]-N-[1-(1,3-dioxol-4-yl)-2-phenylethyl]aniline |
| SMILES | C1=CCCC(CC2=COCC(=Nc3nnc(-c4ccccc4NC(Cc4ccccc4)C4=COCO4)o3)O2)=C1 |
| InChI | InChI=1S/C30H28N4O5/c1-3-9-21(10-4-1)15-23-17-35-19-28(38-23)32-30-34-33-29(39-30)24-13-7-8-14-25(24)31-26(27-18-36-20-37-27)16-22-11-5-2-6-12-22/h1-3,5-9,11-14,17-18,26,31H,4,10,15-16,19-20H2 |
| InChIKey | BEQAECBLECUMRL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|