About 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one
2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one (PubChem CID 90735390) has the molecular formula C19H21F2N5OS
and a molecular weight of 405.47 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one.
Molecular Properties
| Compound Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one |
| PubChem CID | 90735390 |
| Molecular Formula | C19H21F2N5OS |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one |
| SMILES | CC(C)CC(C)Nc1nc(SCc2cccc(F)c2F)nc2[nH]c(=O)cnc12 |
| InChI | InChI=1S/C19H21F2N5OS/c1-10(2)7-11(3)23-17-16-18(24-14(27)8-22-16)26-19(25-17)28-9-12-5-4-6-13(20)15(12)21/h4-6,8,10-11H,7,9H2,1-3H3,(H2,23,24,25,26,27) |
| InChIKey | GKZXZTNIDGPDFT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one?
The IUPAC name of 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one (CID 90735390) is 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one.
What is the SMILES notation for 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one?
The canonical SMILES for 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one is CC(C)CC(C)Nc1nc(SCc2cccc(F)c2F)nc2[nH]c(=O)cnc12.
What is the InChIKey of 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one?
The InChIKey is GKZXZTNIDGPDFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2N5OS/c1-10(2)7-11(3)23-17-16-18(24-14(27)8-22-16)26-19(25-17)28-9-12-5-4-6-13(20)15(12)21/h4-6,8,10-11H,7,9H2,1-3H3,(H2,23,24,25,26,27).
What are the key properties of 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one?
2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one has a molecular weight of 405.47 g/mol, XLogP of 4.13, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-difluorophenyl)methylsulfanyl]-4-(4-methylpentan-2-ylamino)-8H-pteridin-7-one is sourced from PubChem (CID 90735390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).