C21H16N2S — CID 90735429
4-(4-methylphenyl)-2-(4-phenyl-3-pyridinyl)-1,3-thiazole (PubChem CID 90735429) has the molecular formula C21H16N2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-(4-phenyl-3-pyridinyl)-1,3-thiazole.
| Compound Name | 4-(4-methylphenyl)-2-(4-phenyl-3-pyridinyl)-1,3-thiazole |
|---|---|
| PubChem CID | 90735429 |
| Molecular Formula | C21H16N2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-(4-methylphenyl)-2-(4-phenyl-3-pyridinyl)-1,3-thiazole |
| SMILES | Cc1ccc(-c2csc(-c3cnccc3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H16N2S/c1-15-7-9-17(10-8-15)20-14-24-21(23-20)19-13-22-12-11-18(19)16-5-3-2-4-6-16/h2-14H,1H3 |
| InChIKey | OQJMAQUBLBUTFP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |