About 4-butyl-1,4-dimethylpyrimidine
4-butyl-1,4-dimethylpyrimidine (PubChem CID 90735607) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 4-butyl-1,4-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-butyl-1,4-dimethylpyrimidine |
| PubChem CID | 90735607 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 4-butyl-1,4-dimethylpyrimidine |
| SMILES | CCCCC1(C)C=CN(C)C=N1 |
| InChI | InChI=1S/C10H18N2/c1-4-5-6-10(2)7-8-12(3)9-11-10/h7-9H,4-6H2,1-3H3 |
| InChIKey | INFVWIDDCPNDRD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butyl-1,4-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1,4-dimethylpyrimidine?
The IUPAC name of 4-butyl-1,4-dimethylpyrimidine (CID 90735607) is 4-butyl-1,4-dimethylpyrimidine.
What is the SMILES notation for 4-butyl-1,4-dimethylpyrimidine?
The canonical SMILES for 4-butyl-1,4-dimethylpyrimidine is CCCCC1(C)C=CN(C)C=N1.
What is the InChIKey of 4-butyl-1,4-dimethylpyrimidine?
The InChIKey is INFVWIDDCPNDRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-5-6-10(2)7-8-12(3)9-11-10/h7-9H,4-6H2,1-3H3.
What are the key properties of 4-butyl-1,4-dimethylpyrimidine?
4-butyl-1,4-dimethylpyrimidine has a molecular weight of 166.27 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1,4-dimethylpyrimidine is sourced from PubChem (CID 90735607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).