C32H64O2Si3 — CID 90735672
bis[2-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 90735672) has the molecular formula C32H64O2Si3 and a molecular weight of 565.12 g/mol. Its IUPAC name is bis[2-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | bis[2-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 90735672 |
| Molecular Formula | C32H64O2Si3 |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.42 |
| IUPAC Name | bis[2-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC2CCCCC2C1[Si](C)(C)C1C(O[Si](C)(C)C(C)(C)C)CC2CCCCC21 |
| InChI | InChI=1S/C32H64O2Si3/c1-31(2,3)36(9,10)33-27-21-23-17-13-15-19-25(23)29(27)35(7,8)30-26-20-16-14-18-24(26)22-28(30)34-37(11,12)32(4,5)6/h23-30H,13-22H2,1-12H3 |
| InChIKey | NLRUDXULZKBRGB-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|