C29H34F4NO3S2+ — CID 90736161
4-[2-[3-(1,1-difluoroethyl)phenyl]sulfonylpropan-2-yl]-1-[4-(1,1-difluoroprop-2-enyl)-7-propan-2-ylsulfanylcyclohepta-1,3,6-trien-1-yl]piperidin-2-one (PubChem CID 90736161) has the molecular formula C29H34F4NO3S2+ and a molecular weight of 584.72 g/mol. Its IUPAC name is 4-[2-[3-(1,1-difluoroethyl)phenyl]sulfonylpropan-2-yl]-1-[4-(1,1-difluoroprop-2-enyl)-7-propan-2-ylsulfanylcyclohepta-1,3,6-trien-1-yl]piperidin-2-one.
| Compound Name | 4-[2-[3-(1,1-difluoroethyl)phenyl]sulfonylpropan-2-yl]-1-[4-(1,1-difluoroprop-2-enyl)-7-propan-2-ylsulfanylcyclohepta-1,3,6-trien-1-yl]piperidin-2-one |
|---|---|
| PubChem CID | 90736161 |
| Molecular Formula | C29H34F4NO3S2+ |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 4-[2-[3-(1,1-difluoroethyl)phenyl]sulfonylpropan-2-yl]-1-[4-(1,1-difluoroprop-2-enyl)-7-propan-2-ylsulfanylcyclohepta-1,3,6-trien-1-yl]piperidin-2-one |
| SMILES | C=CC(F)(F)C1=CC=C(N2CCC(C([CH2+])(C)S(=O)(=O)c3cccc(C(C)(F)F)c3)CC2=O)C(SC(C)C)=CC1 |
| InChI | InChI=1S/C29H34F4NO3S2/c1-7-29(32,33)20-11-13-24(25(14-12-20)38-19(2)3)34-16-15-21(18-26(34)35)27(4,5)39(36,37)23-10-8-9-22(17-23)28(6,30)31/h7-11,13-14,17,19,21H,1,4,12,15-16,18H2,2-3,5-6H3/q+1 |
| InChIKey | OOIHIVIVLCNJJR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|