About 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium
1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium (PubChem CID 90736826) has the molecular formula C12H22NS+
and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium.
Molecular Properties
| Compound Name | 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium |
| PubChem CID | 90736826 |
| Molecular Formula | C12H22NS+ |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium |
| SMILES | CCCCCC[s+]1c(C)nc(C)c1C |
| InChI | InChI=1S/C12H22NS/c1-5-6-7-8-9-14-11(3)10(2)13-12(14)4/h5-9H2,1-4H3/q+1 |
| InChIKey | VANGXMRQUGZVGL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium?
The IUPAC name of 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium (CID 90736826) is 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium.
What is the SMILES notation for 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium?
The canonical SMILES for 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium is CCCCCC[s+]1c(C)nc(C)c1C.
What is the InChIKey of 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium?
The InChIKey is VANGXMRQUGZVGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22NS/c1-5-6-7-8-9-14-11(3)10(2)13-12(14)4/h5-9H2,1-4H3/q+1.
What are the key properties of 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium?
1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium has a molecular weight of 212.38 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-2,4,5-trimethyl-1,3-thiazol-1-ium is sourced from PubChem (CID 90736826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).