C24H35N7O2 — CID 90736981
4-amino-2-butoxy-8-[[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-5,7-dihydropteridin-6-one (PubChem CID 90736981) has the molecular formula C24H35N7O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 4-amino-2-butoxy-8-[[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-5,7-dihydropteridin-6-one.
| Compound Name | 4-amino-2-butoxy-8-[[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 90736981 |
| Molecular Formula | C24H35N7O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 4-amino-2-butoxy-8-[[3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methyl]-5,7-dihydropteridin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1cccc(CN3CCCN(C)CC3)c1)CC(=O)N2 |
| InChI | InChI=1S/C24H35N7O2/c1-3-4-13-33-24-27-22(25)21-23(28-24)31(17-20(32)26-21)16-19-8-5-7-18(14-19)15-30-10-6-9-29(2)11-12-30/h5,7-8,14H,3-4,6,9-13,15-17H2,1-2H3,(H,26,32)(H2,25,27,28) |
| InChIKey | RFDGGXQOMWMUSD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|