C21H14FIN4O4 — CID 90737018
6-(4-cyano-3-iodophenyl)-7-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid (PubChem CID 90737018) has the molecular formula C21H14FIN4O4 and a molecular weight of 532.27 g/mol. Its IUPAC name is 6-(4-cyano-3-iodophenyl)-7-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid.
| Compound Name | 6-(4-cyano-3-iodophenyl)-7-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 90737018 |
| Molecular Formula | C21H14FIN4O4 |
| Molecular Weight | 532.27 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | 6-(4-cyano-3-iodophenyl)-7-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
| SMILES | N#Cc1ccc(C23C(=O)NC(=O)N2C2CN(C(=O)O)C3(c3ccc(F)cc3)C2)cc1I |
| InChI | InChI=1S/C21H14FIN4O4/c22-14-5-3-12(4-6-14)20-8-15(10-26(20)19(30)31)27-18(29)25-17(28)21(20,27)13-2-1-11(9-24)16(23)7-13/h1-7,15H,8,10H2,(H,30,31)(H,25,28,29) |
| InChIKey | FWRSRRFBGBVDRJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|