About ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one
ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 90737087) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one.
Molecular Properties
| Compound Name | ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one |
| PubChem CID | 90737087 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | CC.O=C1OC2(CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C12H13NO2.C2H6/c14-11-9-3-1-2-4-10(9)12(15-11)5-7-13-8-6-12;1-2/h1-4,13H,5-8H2;1-2H3 |
| InChIKey | OHXRUIYGVQMPAZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one?
The IUPAC name of ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one (CID 90737087) is ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one.
What is the SMILES notation for ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one?
The canonical SMILES for ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one is CC.O=C1OC2(CCNCC2)c2ccccc21.
What is the InChIKey of ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one?
The InChIKey is OHXRUIYGVQMPAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2.C2H6/c14-11-9-3-1-2-4-10(9)12(15-11)5-7-13-8-6-12;1-2/h1-4,13H,5-8H2;1-2H3.
What are the key properties of ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one?
ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one has a molecular weight of 233.31 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;spiro[2-benzofuran-3,4'-piperidine]-1-one is sourced from PubChem (CID 90737087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).