C11H17N — CID 90737213
(2E,6Z)-5-methyl-2-propan-2-yl-4,5-dihydroazocine (PubChem CID 90737213) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (2E,6Z)-5-methyl-2-propan-2-yl-4,5-dihydroazocine.
| Compound Name | (2E,6Z)-5-methyl-2-propan-2-yl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 90737213 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2E,6Z)-5-methyl-2-propan-2-yl-4,5-dihydroazocine |
| SMILES | CC1/C=C\C=N/C(C(C)C)=C\C1 |
| InChI | InChI=1S/C11H17N/c1-9(2)11-7-6-10(3)5-4-8-12-11/h4-5,7-10H,6H2,1-3H3/b5-4-,11-7-,12-8- |
| InChIKey | SZHNSDNGLHAEBO-KOALAAFWSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |