C23H37N5O6 — CID 90737405
(2R)-N-[3,3-dimethyl-1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]-1-oxobutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide (PubChem CID 90737405) has the molecular formula C23H37N5O6 and a molecular weight of 479.58 g/mol. Its IUPAC name is (2R)-N-[3,3-dimethyl-1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]-1-oxobutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide.
| Compound Name | (2R)-N-[3,3-dimethyl-1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]-1-oxobutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide |
|---|---|
| PubChem CID | 90737405 |
| Molecular Formula | C23H37N5O6 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | (2R)-N-[3,3-dimethyl-1-[4-(5-methyl-1,2-oxazole-3-carbonyl)piperazin-1-yl]-1-oxobutan-2-yl]-2-[[formyl(hydroxy)amino]methyl]hexanamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)NC(C(=O)N1CCN(C(=O)c2cc(C)on2)CC1)C(C)(C)C |
| InChI | InChI=1S/C23H37N5O6/c1-6-7-8-17(14-28(33)15-29)20(30)24-19(23(3,4)5)22(32)27-11-9-26(10-12-27)21(31)18-13-16(2)34-25-18/h13,15,17,19,33H,6-12,14H2,1-5H3,(H,24,30)/t17-,19?/m1/s1 |
| InChIKey | JHSYEFFHPNGYIJ-DUSLRRAJSA-N |
| XLogP | 1.45 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|