C10H10F3N3O3 — CID 90737610
[2-amino-1-oxo-1-(pyridin-4-ylamino)propan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 90737610) has the molecular formula C10H10F3N3O3 and a molecular weight of 277.20 g/mol. Its IUPAC name is [2-amino-1-oxo-1-(pyridin-4-ylamino)propan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-amino-1-oxo-1-(pyridin-4-ylamino)propan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90737610 |
| Molecular Formula | C10H10F3N3O3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | [2-amino-1-oxo-1-(pyridin-4-ylamino)propan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(N)(OC(=O)C(F)(F)F)C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C10H10F3N3O3/c1-9(14,19-8(18)10(11,12)13)7(17)16-6-2-4-15-5-3-6/h2-5H,14H2,1H3,(H,15,16,17) |
| InChIKey | YCDRHGQKJAPENB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|