C8H17F3NO8S2- — CID 90737691
azanium 3-methyl-3-(sulfonatooxymethyl)-4-(2,2,2-trifluoroethoxy)butane-1-sulfonate (PubChem CID 90737691) has the molecular formula C8H17F3NO8S2- and a molecular weight of 376.35 g/mol. Its IUPAC name is azanium 3-methyl-3-(sulfonatooxymethyl)-4-(2,2,2-trifluoroethoxy)butane-1-sulfonate.
| Compound Name | azanium 3-methyl-3-(sulfonatooxymethyl)-4-(2,2,2-trifluoroethoxy)butane-1-sulfonate |
|---|---|
| PubChem CID | 90737691 |
| Molecular Formula | C8H17F3NO8S2- |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | azanium 3-methyl-3-(sulfonatooxymethyl)-4-(2,2,2-trifluoroethoxy)butane-1-sulfonate |
| SMILES | CC(CCS(=O)(=O)[O-])(COCC(F)(F)F)COS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C8H15F3O8S2.H3N/c1-7(2-3-20(12,13)14,5-19-21(15,16)17)4-18-6-8(9,10)11;/h2-6H2,1H3,(H,12,13,14)(H,15,16,17);1H3/p-1 |
| InChIKey | DQBIMEBYPYKVAA-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|