C27H23FN2O6 — CID 90737731
(4R,7R)-4-[2-(4-fluorophenoxy)ethyl]-7-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3-diol (PubChem CID 90737731) has the molecular formula C27H23FN2O6 and a molecular weight of 490.49 g/mol. Its IUPAC name is (4R,7R)-4-[2-(4-fluorophenoxy)ethyl]-7-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3-diol.
| Compound Name | (4R,7R)-4-[2-(4-fluorophenoxy)ethyl]-7-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 90737731 |
| Molecular Formula | C27H23FN2O6 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (4R,7R)-4-[2-(4-fluorophenoxy)ethyl]-7-methyl-2-(4-nitronaphthalen-1-yl)-5,6-dihydro-4,7-epoxyisoindole-1,3-diol |
| SMILES | C[C@]12CC[C@](CCOc3ccc(F)cc3)(O1)c1c2c(O)n(-c2ccc([N+](=O)[O-])c3ccccc23)c1O |
| InChI | InChI=1S/C27H23FN2O6/c1-26-12-13-27(36-26,14-15-35-17-8-6-16(28)7-9-17)23-22(26)24(31)29(25(23)32)20-10-11-21(30(33)34)19-5-3-2-4-18(19)20/h2-11,31-32H,12-15H2,1H3/t26-,27-/m1/s1 |
| InChIKey | RLIQCCWGLSFMAK-KAYWLYCHSA-N |
| XLogP | 5.79 |
| TPSA | 106.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|