About 3-ethyl-2-methylpentane
3-ethyl-2-methylpentane (PubChem CID 90737744) has the molecular formula C8H17+
and a molecular weight of 113.22 g/mol. Its IUPAC name is 3-ethyl-2-methylpentane.
Molecular Properties
| Compound Name | 3-ethyl-2-methylpentane |
| PubChem CID | 90737744 |
| Molecular Formula | C8H17+ |
| Molecular Weight | 113.22 g/mol |
| Exact Mass | 113.13 |
| IUPAC Name | 3-ethyl-2-methylpentane |
| SMILES | C[CH+]C(CC)C(C)C |
| InChI | InChI=1S/C8H17/c1-5-8(6-2)7(3)4/h5,7-8H,6H2,1-4H3/q+1 |
| InChIKey | SZHBRTYVHRBBDS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-methylpentane?
The IUPAC name of 3-ethyl-2-methylpentane (CID 90737744) is 3-ethyl-2-methylpentane.
What is the SMILES notation for 3-ethyl-2-methylpentane?
The canonical SMILES for 3-ethyl-2-methylpentane is C[CH+]C(CC)C(C)C.
What is the InChIKey of 3-ethyl-2-methylpentane?
The InChIKey is SZHBRTYVHRBBDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17/c1-5-8(6-2)7(3)4/h5,7-8H,6H2,1-4H3/q+1.
What are the key properties of 3-ethyl-2-methylpentane?
3-ethyl-2-methylpentane has a molecular weight of 113.22 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-methylpentane is sourced from PubChem (CID 90737744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).