About 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane
2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane (PubChem CID 90737757) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane |
| PubChem CID | 90737757 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane |
| SMILES | CCCC(CCC)CN1CC2(CCN(C)CC2)OC1C |
| InChI | InChI=1S/C17H34N2O/c1-5-7-16(8-6-2)13-19-14-17(20-15(19)3)9-11-18(4)12-10-17/h15-16H,5-14H2,1-4H3 |
| InChIKey | GEQJICMGSQTWMO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane?
The IUPAC name of 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane (CID 90737757) is 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane.
What is the SMILES notation for 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane?
The canonical SMILES for 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane is CCCC(CCC)CN1CC2(CCN(C)CC2)OC1C.
What is the InChIKey of 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane?
The InChIKey is GEQJICMGSQTWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O/c1-5-7-16(8-6-2)13-19-14-17(20-15(19)3)9-11-18(4)12-10-17/h15-16H,5-14H2,1-4H3.
What are the key properties of 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane?
2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane has a molecular weight of 282.47 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethyl-3-(2-propylpentyl)-1-oxa-3,8-diazaspiro[4.5]decane is sourced from PubChem (CID 90737757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).