C18H14F4N2O5 — CID 90737908
4-[(4R,5S,7S)-5-fluoro-1,3,6,6-tetrahydroxy-4,7-dimethyl-5H-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 90737908) has the molecular formula C18H14F4N2O5 and a molecular weight of 414.31 g/mol. Its IUPAC name is 4-[(4R,5S,7S)-5-fluoro-1,3,6,6-tetrahydroxy-4,7-dimethyl-5H-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4R,5S,7S)-5-fluoro-1,3,6,6-tetrahydroxy-4,7-dimethyl-5H-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 90737908 |
| Molecular Formula | C18H14F4N2O5 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 4-[(4R,5S,7S)-5-fluoro-1,3,6,6-tetrahydroxy-4,7-dimethyl-5H-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@]12O[C@](C)(c3c1c(O)n(-c1ccc(C#N)c(C(F)(F)F)c1)c3O)[C@H](F)C2(O)O |
| InChI | InChI=1S/C18H14F4N2O5/c1-15-10-11(16(2,29-15)17(27,28)14(15)19)13(26)24(12(10)25)8-4-3-7(6-23)9(5-8)18(20,21)22/h3-5,14,25-28H,1-2H3/t14-,15+,16-/m0/s1 |
| InChIKey | MSPMRHJALUAXPP-XHSDSOJGSA-N |
| XLogP | 2.27 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|