C19H15F3N2O4 — CID 90738349
4-[(4R,7S)-1,3-dihydroxy-4-(2-hydroxyethyl)-7-methyl-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 90738349) has the molecular formula C19H15F3N2O4 and a molecular weight of 392.33 g/mol. Its IUPAC name is 4-[(4R,7S)-1,3-dihydroxy-4-(2-hydroxyethyl)-7-methyl-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4R,7S)-1,3-dihydroxy-4-(2-hydroxyethyl)-7-methyl-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 90738349 |
| Molecular Formula | C19H15F3N2O4 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 4-[(4R,7S)-1,3-dihydroxy-4-(2-hydroxyethyl)-7-methyl-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C[C@@]12C=C[C@@](CCO)(O1)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C19H15F3N2O4/c1-17-4-5-18(28-17,6-7-25)14-13(17)15(26)24(16(14)27)11-3-2-10(9-23)12(8-11)19(20,21)22/h2-5,8,25-27H,6-7H2,1H3/t17-,18-/m0/s1 |
| InChIKey | JBVJPOTYMZRZRS-ROUUACIJSA-N |
| XLogP | 3.17 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|