C18H21N3P2 — CID 90738421
diphenyl(1,3,5-triaza-7-phosphatricyclo[3.3.1.13,7]decan-6-yl)phosphane (PubChem CID 90738421) has the molecular formula C18H21N3P2 and a molecular weight of 341.33 g/mol. Its IUPAC name is diphenyl(1,3,5-triaza-7-phosphatricyclo[3.3.1.13,7]decan-6-yl)phosphane.
| Compound Name | diphenyl(1,3,5-triaza-7-phosphatricyclo[3.3.1.13,7]decan-6-yl)phosphane |
|---|---|
| PubChem CID | 90738421 |
| Molecular Formula | C18H21N3P2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | diphenyl(1,3,5-triaza-7-phosphatricyclo[3.3.1.13,7]decan-6-yl)phosphane |
| SMILES | c1ccc(P(c2ccccc2)C2N3CN4CN(C3)CP2C4)cc1 |
| InChI | InChI=1S/C18H21N3P2/c1-3-7-16(8-4-1)23(17-9-5-2-6-10-17)18-21-12-19-11-20(13-21)15-22(18)14-19/h1-10,18H,11-15H2 |
| InChIKey | BGLKOGAYHWHLED-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|