C19H17F3N2O4 — CID 90738532
(5S)-2-[4-isocyano-2-methyl-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 90738532) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is (5S)-2-[4-isocyano-2-methyl-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | (5S)-2-[4-isocyano-2-methyl-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 90738532 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (5S)-2-[4-isocyano-2-methyl-3-(trifluoromethyl)phenyl]-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(C)OC3(C)C[C@@H]2O)c(C)c1C(F)(F)F |
| InChI | InChI=1S/C19H17F3N2O4/c1-8-10(6-5-9(23-4)12(8)19(20,21)22)24-15(26)13-14(16(24)27)18(3)11(25)7-17(13,2)28-18/h5-6,11,25-27H,7H2,1-3H3/t11-,17?,18?/m0/s1 |
| InChIKey | YZDKDRXVEBVQHP-NVWNAPEYSA-N |
| XLogP | 3.99 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|